C19H29N3O2 — CID 133469048
ethyl 2-[[1-(cyclopentylmethyl)piperidin-4-yl]amino]pyridine-3-carboxylate (PubChem CID 133469048) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is ethyl 2-[[1-(cyclopentylmethyl)piperidin-4-yl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[1-(cyclopentylmethyl)piperidin-4-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133469048 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | ethyl 2-[[1-(cyclopentylmethyl)piperidin-4-yl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NC1CCN(CC2CCCC2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-24-19(23)17-8-5-11-20-18(17)21-16-9-12-22(13-10-16)14-15-6-3-4-7-15/h5,8,11,15-16H,2-4,6-7,9-10,12-14H2,1H3,(H,20,21) |
| InChIKey | AOZNNYMKYUMJNI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |