C13H18N2O4S — CID 63921994
ethyl 2-[(1,1-dioxothian-3-yl)amino]pyridine-3-carboxylate (PubChem CID 63921994) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothian-3-yl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(1,1-dioxothian-3-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 63921994 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 2-[(1,1-dioxothian-3-yl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O4S/c1-2-19-13(16)11-6-3-7-14-12(11)15-10-5-4-8-20(17,18)9-10/h3,6-7,10H,2,4-5,8-9H2,1H3,(H,14,15) |
| InChIKey | PCOYOBMQKMOYRV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |