C10H12N2O2 — CID 60722666
methyl 2-(cyclopropylamino)pyridine-3-carboxylate (PubChem CID 60722666) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-(cyclopropylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 60722666 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | methyl 2-(cyclopropylamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NC1CC1 |
| InChI | InChI=1S/C10H12N2O2/c1-14-10(13)8-3-2-6-11-9(8)12-7-4-5-7/h2-3,6-7H,4-5H2,1H3,(H,11,12) |
| InChIKey | BNACOUZLQYIZEW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |