C17H20N4O2 — CID 142730255
methyl 2-[4-(pyrrolidin-3-ylamino)anilino]pyridine-3-carboxylate (PubChem CID 142730255) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 2-[4-(pyrrolidin-3-ylamino)anilino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[4-(pyrrolidin-3-ylamino)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142730255 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | methyl 2-[4-(pyrrolidin-3-ylamino)anilino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1Nc1ccc(NC2CCNC2)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-23-17(22)15-3-2-9-19-16(15)21-13-6-4-12(5-7-13)20-14-8-10-18-11-14/h2-7,9,14,18,20H,8,10-11H2,1H3,(H,19,21) |
| InChIKey | JITCJXABCUCIGM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |