C17H17F3N4O — CID 119450033
N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 119450033) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119450033 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCNC1)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N4O/c18-17(19,20)11-3-1-4-12(9-11)23-15-14(5-2-7-22-15)16(25)24-13-6-8-21-10-13/h1-5,7,9,13,21H,6,8,10H2,(H,22,23)(H,24,25) |
| InChIKey | DXCBCSDDMWTGEL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |