C13H16F3N3O2 — CID 119428934
N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 119428934) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119428934 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCNC1)c1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)8-21-12-10(4-2-6-18-12)11(20)19-9-3-1-5-17-7-9/h2,4,6,9,17H,1,3,5,7-8H2,(H,19,20) |
| InChIKey | UHRXNHXESMNGLP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |