C15H15ClF3N5O — CID 119426018
1-(3-chloro-2-pyridinyl)-N-piperidin-3-yl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 119426018) has the molecular formula C15H15ClF3N5O and a molecular weight of 373.77 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-piperidin-3-yl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-piperidin-3-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119426018 |
| Molecular Formula | C15H15ClF3N5O |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-piperidin-3-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCCNC1)c1cnn(-c2ncccc2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C15H15ClF3N5O/c16-11-4-2-6-21-13(11)24-12(15(17,18)19)10(8-22-24)14(25)23-9-3-1-5-20-7-9/h2,4,6,8-9,20H,1,3,5,7H2,(H,23,25) |
| InChIKey | PTEMVXDNEWDXIC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |