C15H11BrF3N3O3 — CID 31853242
N'-(2-bromobenzoyl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide (PubChem CID 31853242) has the molecular formula C15H11BrF3N3O3 and a molecular weight of 418.17 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 31853242 |
| Molecular Formula | C15H11BrF3N3O3 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N'-(2-bromobenzoyl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccnc1OCC(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C15H11BrF3N3O3/c16-11-6-2-1-4-9(11)12(23)21-22-13(24)10-5-3-7-20-14(10)25-8-15(17,18)19/h1-7H,8H2,(H,21,23)(H,22,24) |
| InChIKey | ZUNXZKBLFPYPPK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|