C21H18F3N3O — CID 66883790
N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)phenyl]quinoline-8-carboxamide (PubChem CID 66883790) has the molecular formula C21H18F3N3O and a molecular weight of 385.39 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)phenyl]quinoline-8-carboxamide.
| Compound Name | N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)phenyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 66883790 |
| Molecular Formula | C21H18F3N3O |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-pyrrolidin-3-yl-2-[3-(trifluoromethyl)phenyl]quinoline-8-carboxamide |
| SMILES | O=C(NC1CCNC1)c1cccc2ccc(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C21H18F3N3O/c22-21(23,24)15-5-1-4-14(11-15)18-8-7-13-3-2-6-17(19(13)27-18)20(28)26-16-9-10-25-12-16/h1-8,11,16,25H,9-10,12H2,(H,26,28) |
| InChIKey | NENNUZWUHCVECE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |