C18H14F3N5O2 — CID 78813930
N'-(1H-pyrrole-2-carbonyl)-2-[3-(trifluoromethyl)anilino]pyridine-3-carbohydrazide (PubChem CID 78813930) has the molecular formula C18H14F3N5O2 and a molecular weight of 389.34 g/mol. Its IUPAC name is N'-(1H-pyrrole-2-carbonyl)-2-[3-(trifluoromethyl)anilino]pyridine-3-carbohydrazide.
| Compound Name | N'-(1H-pyrrole-2-carbonyl)-2-[3-(trifluoromethyl)anilino]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 78813930 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N'-(1H-pyrrole-2-carbonyl)-2-[3-(trifluoromethyl)anilino]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1)c1ccc[nH]1 |
| InChI | InChI=1S/C18H14F3N5O2/c19-18(20,21)11-4-1-5-12(10-11)24-15-13(6-2-9-23-15)16(27)25-26-17(28)14-7-3-8-22-14/h1-10,22H,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | QZPUZOHDCLCGOZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|