C16H16F3N2O4P — CID 89290625
2-dimethoxyphosphoryl-1-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]ethanone (PubChem CID 89290625) has the molecular formula C16H16F3N2O4P and a molecular weight of 388.28 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-1-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]ethanone.
| Compound Name | 2-dimethoxyphosphoryl-1-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 89290625 |
| Molecular Formula | C16H16F3N2O4P |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-dimethoxyphosphoryl-1-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]ethanone |
| SMILES | COP(=O)(CC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C16H16F3N2O4P/c1-24-26(23,25-2)10-14(22)13-7-4-8-20-15(13)21-12-6-3-5-11(9-12)16(17,18)19/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | PRUXHCMQAXTGBB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|