C18H20F3N2O3P — CID 12669147
3-dimethylphosphorylpropyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 12669147) has the molecular formula C18H20F3N2O3P and a molecular weight of 400.34 g/mol. Its IUPAC name is 3-dimethylphosphorylpropyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | 3-dimethylphosphorylpropyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 12669147 |
| Molecular Formula | C18H20F3N2O3P |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-dimethylphosphorylpropyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CP(C)(=O)CCCOC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N2O3P/c1-27(2,25)11-5-10-26-17(24)15-8-4-9-22-16(15)23-14-7-3-6-13(12-14)18(19,20)21/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,22,23) |
| InChIKey | QKAMVQPFBSUSMM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|