C23H18F3N3O4 — CID 2373171
[2-(4-acetylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 2373171) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2373171 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)c2cccnc2Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H18F3N3O4/c1-14(30)15-7-9-17(10-8-15)28-20(31)13-33-22(32)19-6-3-11-27-21(19)29-18-5-2-4-16(12-18)23(24,25)26/h2-12H,13H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | SMHXZQFLUZBFQF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |