C22H17F3N4O6 — CID 4535279
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 4535279) has the molecular formula C22H17F3N4O6 and a molecular weight of 490.39 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4535279 |
| Molecular Formula | C22H17F3N4O6 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccnc2Nc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17F3N4O6/c1-34-15-7-8-17(18(11-15)29(32)33)28-19(30)12-35-21(31)16-6-3-9-26-20(16)27-14-5-2-4-13(10-14)22(23,24)25/h2-11H,12H2,1H3,(H,26,27)(H,28,30) |
| InChIKey | UMTYGTBBVCDTEJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|