C17H16F3N3O3 — CID 2365493
[2-(ethylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 2365493) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2365493 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CCNC(=O)COC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-2-21-14(24)10-26-16(25)13-7-4-8-22-15(13)23-12-6-3-5-11(9-12)17(18,19)20/h3-9H,2,10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | MSGSJDKWDSOZKZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |