C19H20F3N3O3 — CID 2363934
[2-(tert-butylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 2363934) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2363934 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-18(2,3)25-15(26)11-28-17(27)14-8-5-9-23-16(14)24-13-7-4-6-12(10-13)19(20,21)22/h4-10H,11H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | DTVAAXBNRYLLQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |