C23H20F3N3O3 — CID 2342660
[2-[benzyl(methyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 2342660) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2342660 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CN(Cc1ccccc1)C(=O)COC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N3O3/c1-29(14-16-7-3-2-4-8-16)20(30)15-32-22(31)19-11-6-12-27-21(19)28-18-10-5-9-17(13-18)23(24,25)26/h2-13H,14-15H2,1H3,(H,27,28) |
| InChIKey | LVABKBGVLPBFKK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |