C24H17F4N3O7 — CID 3362785
[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate (PubChem CID 3362785) has the molecular formula C24H17F4N3O7 and a molecular weight of 535.41 g/mol. Its IUPAC name is [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate.
| Compound Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
|---|---|
| PubChem CID | 3362785 |
| Molecular Formula | C24H17F4N3O7 |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
| SMILES | O=C(COc1ccccc1C(=O)OCC(=O)Nc1ccc(F)cc1[N+](=O)[O-])Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F4N3O7/c25-15-8-9-18(19(11-15)31(35)36)30-22(33)13-38-23(34)17-6-1-2-7-20(17)37-12-21(32)29-16-5-3-4-14(10-16)24(26,27)28/h1-11H,12-13H2,(H,29,32)(H,30,33) |
| InChIKey | WCWIRTUPAXGSDO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|