C16H9BrF4N2O5 — CID 27751366
[2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 27751366) has the molecular formula C16H9BrF4N2O5 and a molecular weight of 465.15 g/mol. Its IUPAC name is [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 27751366 |
| Molecular Formula | C16H9BrF4N2O5 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Br)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9BrF4N2O5/c17-11-6-9(18)2-3-10(11)15(25)28-7-14(24)22-12-4-1-8(16(19,20)21)5-13(12)23(26)27/h1-6H,7H2,(H,22,24) |
| InChIKey | JETROXFFVAUMLA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|