C18H15F3N2O6 — CID 8011903
[2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate (PubChem CID 8011903) has the molecular formula C18H15F3N2O6 and a molecular weight of 412.32 g/mol. Its IUPAC name is [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8011903 |
| Molecular Formula | C18H15F3N2O6 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15F3N2O6/c1-28-13-5-2-11(3-6-13)8-17(25)29-10-16(24)22-14-7-4-12(18(19,20)21)9-15(14)23(26)27/h2-7,9H,8,10H2,1H3,(H,22,24) |
| InChIKey | MYSNZOJQZNZEPS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|