C18H15F3N4O7 — CID 4831651
[2-(2-nitroanilino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 4831651) has the molecular formula C18H15F3N4O7 and a molecular weight of 456.33 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 4831651 |
| Molecular Formula | C18H15F3N4O7 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | CC(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)OCC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15F3N4O7/c1-10(22-13-7-6-11(18(19,20)21)8-15(13)25(30)31)17(27)32-9-16(26)23-12-4-2-3-5-14(12)24(28)29/h2-8,10,22H,9H2,1H3,(H,23,26) |
| InChIKey | MXSADMBAZFTGCB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|