C19H24F3N3O5 — CID 25421348
[2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 25421348) has the molecular formula C19H24F3N3O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 25421348 |
| Molecular Formula | C19H24F3N3O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | C[C@H](Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)OCC(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H24F3N3O5/c1-11-5-3-4-6-14(11)24-17(26)10-30-18(27)12(2)23-15-8-7-13(19(20,21)22)9-16(15)25(28)29/h7-9,11-12,14,23H,3-6,10H2,1-2H3,(H,24,26)/t11-,12-,14+/m0/s1 |
| InChIKey | HTCCSKZTEHAQOX-SGMGOOAPSA-N |
| XLogP | 3.65 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|