C19H17F3N2O5 — CID 7611719
(4-propanoylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 7611719) has the molecular formula C19H17F3N2O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is (4-propanoylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | (4-propanoylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 7611719 |
| Molecular Formula | C19H17F3N2O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (4-propanoylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | CCC(=O)c1ccc(OC(=O)[C@H](C)Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17F3N2O5/c1-3-17(25)12-4-7-14(8-5-12)29-18(26)11(2)23-15-9-6-13(19(20,21)22)10-16(15)24(27)28/h4-11,23H,3H2,1-2H3/t11-/m0/s1 |
| InChIKey | MRKOEUZVZRUHGK-NSHDSACASA-N |
| XLogP | 4.61 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|