C19H14ClF6N3O5 — CID 3957200
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 3957200) has the molecular formula C19H14ClF6N3O5 and a molecular weight of 513.78 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 3957200 |
| Molecular Formula | C19H14ClF6N3O5 |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | CC(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H14ClF6N3O5/c1-9(27-13-5-3-11(19(24,25)26)7-15(13)29(32)33)17(31)34-8-16(30)28-14-6-10(18(21,22)23)2-4-12(14)20/h2-7,9,27H,8H2,1H3,(H,28,30) |
| InChIKey | VNUQCOCQWYGQSL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|