C23H21F3N4O5S — CID 3249937
[2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 3249937) has the molecular formula C23H21F3N4O5S and a molecular weight of 522.51 g/mol. Its IUPAC name is [2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | [2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 3249937 |
| Molecular Formula | C23H21F3N4O5S |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [2-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | Cc1ccc(-c2csc(NC(=O)COC(=O)C(C)Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])n2)cc1C |
| InChI | InChI=1S/C23H21F3N4O5S/c1-12-4-5-15(8-13(12)2)18-11-36-22(28-18)29-20(31)10-35-21(32)14(3)27-17-7-6-16(23(24,25)26)9-19(17)30(33)34/h4-9,11,14,27H,10H2,1-3H3,(H,28,29,31) |
| InChIKey | SOSQVIIUMFHAHF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|