C16H19N3O3S — CID 134041757
3,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 134041757) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 3,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 134041757 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CC(C)(C)C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O3S/c1-10-5-6-11(7-13(10)19(21)22)12-9-23-15(17-12)18-14(20)8-16(2,3)4/h5-7,9H,8H2,1-4H3,(H,17,18,20) |
| InChIKey | OZECACSLJVTPHX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|