C22H24N4O5S2 — CID 55469346
5-(tert-butylsulfamoyl)-2-methyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 55469346) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-2-methyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-2-methyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 55469346 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-2-methyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)cc1C(=O)Nc1nc(-c2ccc(C)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C22H24N4O5S2/c1-13-7-9-16(33(30,31)25-22(3,4)5)11-17(13)20(27)24-21-23-18(12-32-21)15-8-6-14(2)19(10-15)26(28)29/h6-12,25H,1-5H3,(H,23,24,27) |
| InChIKey | LZQDLWLIAPSXMT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|