C18H12N6O3S2 — CID 55870173
N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 55870173) has the molecular formula C18H12N6O3S2 and a molecular weight of 424.47 g/mol. Its IUPAC name is N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55870173 |
| Molecular Formula | C18H12N6O3S2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3csc(-c4ncccn4)n3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N6O3S2/c1-10-3-4-11(7-14(10)24(26)27)12-8-29-18(22-12)23-16(25)13-9-28-17(21-13)15-19-5-2-6-20-15/h2-9H,1H3,(H,22,23,25) |
| InChIKey | UIQYDWSURUWZHD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|