C19H16N6O3S — CID 78839468
1,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 78839468) has the molecular formula C19H16N6O3S and a molecular weight of 408.44 g/mol. Its IUPAC name is 1,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | 1,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 78839468 |
| Molecular Formula | C19H16N6O3S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1,3-dimethyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cnc4c(c3)c(C)nn4C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N6O3S/c1-10-4-5-12(7-16(10)25(27)28)15-9-29-19(21-15)22-18(26)13-6-14-11(2)23-24(3)17(14)20-8-13/h4-9H,1-3H3,(H,21,22,26) |
| InChIKey | TUMFRGXIEARKAH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|