C21H15N5O5S — CID 86952683
3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 86952683) has the molecular formula C21H15N5O5S and a molecular weight of 449.45 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 86952683 |
| Molecular Formula | C21H15N5O5S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cccc(-n4[nH]c(=O)ccc4=O)c3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15N5O5S/c1-12-5-6-13(10-17(12)26(30)31)16-11-32-21(22-16)23-20(29)14-3-2-4-15(9-14)25-19(28)8-7-18(27)24-25/h2-11H,1H3,(H,24,27)(H,22,23,29) |
| InChIKey | GENNWINOAUHKMN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 139.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|