C19H18N4O4S2 — CID 55493747
3-acetamido-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylpropanamide (PubChem CID 55493747) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-acetamido-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylpropanamide.
| Compound Name | 3-acetamido-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55493747 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 3-acetamido-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylpropanamide |
| SMILES | CC(=O)NC(CC(=O)Nc1nc(-c2ccc(C)c([N+](=O)[O-])c2)cs1)c1cccs1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-11-5-6-13(8-16(11)23(26)27)15-10-29-19(21-15)22-18(25)9-14(20-12(2)24)17-4-3-7-28-17/h3-8,10,14H,9H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | AJNBLYKLYVPQGS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|