C18H21N3O5S2 — CID 55759416
3-cyclopentylsulfonyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 55759416) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55759416 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CCS(=O)(=O)C3CCCC3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O5S2/c1-12-6-7-13(10-16(12)21(23)24)15-11-27-18(19-15)20-17(22)8-9-28(25,26)14-4-2-3-5-14/h6-7,10-11,14H,2-5,8-9H2,1H3,(H,19,20,22) |
| InChIKey | AEZKVXRSWAEBFG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|