C17H19IN2O3S2 — CID 55760133
3-cyclopentylsulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 55760133) has the molecular formula C17H19IN2O3S2 and a molecular weight of 490.39 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55760133 |
| Molecular Formula | C17H19IN2O3S2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)Nc1nc(-c2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C17H19IN2O3S2/c18-13-7-5-12(6-8-13)15-11-24-17(19-15)20-16(21)9-10-25(22,23)14-3-1-2-4-14/h5-8,11,14H,1-4,9-10H2,(H,19,20,21) |
| InChIKey | IDUUSCFJKGTWGY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|