C19H25N3O3S2 — CID 118362933
N-[4-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 118362933) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[4-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | N-[4-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 118362933 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[4-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc(-c2ccc(S(=O)(=O)N3CCCCC3C)cc2)cs1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-3-6-18(23)21-19-20-17(13-26-19)15-8-10-16(11-9-15)27(24,25)22-12-5-4-7-14(22)2/h8-11,13-14H,3-7,12H2,1-2H3,(H,20,21,23) |
| InChIKey | SLAMNMXSBVHYSJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |