C21H21N3O3S2 — CID 2318282
(2R)-1-(benzenesulfonyl)-N-(4-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide (PubChem CID 2318282) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N-(4-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | (2R)-1-(benzenesulfonyl)-N-(4-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 2318282 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N-(4-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)[C@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O3S2/c25-20(23-21-22-18(15-28-21)16-9-3-1-4-10-16)19-13-7-8-14-24(19)29(26,27)17-11-5-2-6-12-17/h1-6,9-12,15,19H,7-8,13-14H2,(H,22,23,25)/t19-/m1/s1 |
| InChIKey | KTEFAYCEBCKRTL-LJQANCHMSA-N |
| XLogP | 3.99 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |