C21H20N4O5S2 — CID 16827331
1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide (PubChem CID 16827331) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16827331 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C21H20N4O5S2/c1-14-4-10-17(11-5-14)32(29,30)24-12-2-3-19(24)20(26)23-21-22-18(13-31-21)15-6-8-16(9-7-15)25(27)28/h4-11,13,19H,2-3,12H2,1H3,(H,22,23,26) |
| InChIKey | CMJZYDZVXNZWHA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|