C22H22N4O5S3 — CID 16934370
1-(4-methylsulfanylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 16934370) has the molecular formula C22H22N4O5S3 and a molecular weight of 518.64 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methylsulfanylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16934370 |
| Molecular Formula | C22H22N4O5S3 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)sulfonyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CSc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3nc(-c4ccc([N+](=O)[O-])cc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C22H22N4O5S3/c1-32-18-6-8-19(9-7-18)34(30,31)25-12-10-16(11-13-25)21(27)24-22-23-20(14-33-22)15-2-4-17(5-3-15)26(28)29/h2-9,14,16H,10-13H2,1H3,(H,23,24,27) |
| InChIKey | ZGEGEXCQTPZVOK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|