C19H18N4O5S3 — CID 16827355
1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide (PubChem CID 16827355) has the molecular formula C19H18N4O5S3 and a molecular weight of 478.58 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16827355 |
| Molecular Formula | C19H18N4O5S3 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2nc(-c3cc([N+](=O)[O-])cs3)cs2)cc1 |
| InChI | InChI=1S/C19H18N4O5S3/c1-12-4-6-14(7-5-12)31(27,28)22-8-2-3-16(22)18(24)21-19-20-15(11-30-19)17-9-13(10-29-17)23(25)26/h4-7,9-11,16H,2-3,8H2,1H3,(H,20,21,24) |
| InChIKey | MNGQRYDIHISYDM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|