C18H14ClIN2O3S2 — CID 44994731
3-(4-chlorophenyl)sulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 44994731) has the molecular formula C18H14ClIN2O3S2 and a molecular weight of 532.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 44994731 |
| Molecular Formula | C18H14ClIN2O3S2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 531.92 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Cl)cc1)Nc1nc(-c2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C18H14ClIN2O3S2/c19-13-3-7-15(8-4-13)27(24,25)10-9-17(23)22-18-21-16(11-26-18)12-1-5-14(20)6-2-12/h1-8,11H,9-10H2,(H,21,22,23) |
| InChIKey | WNAXVBIFRWQODQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|