C16H19N3O3S2 — CID 55880683
3-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide (PubChem CID 55880683) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 55880683 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C16H19N3O3S2/c20-14(10-11-24(21,22)13-8-4-5-9-13)17-16-18-15(19-23-16)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,17,18,19,20) |
| InChIKey | DFVJJBDXCKANGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |