C18H21ClN2OS — CID 3342805
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide (PubChem CID 3342805) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 3342805 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H21ClN2OS/c19-15-9-7-14(8-10-15)16-12-23-18(20-16)21-17(22)11-6-13-4-2-1-3-5-13/h7-10,12-13H,1-6,11H2,(H,20,21,22) |
| InChIKey | GBPIWVGYJAXPKV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |