C21H19N5O4S — CID 55469439
3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 55469439) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55469439 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CCc3c(C)[nH]c(=O)c(C#N)c3C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N5O4S/c1-11-4-5-14(8-18(11)26(29)30)17-10-31-21(24-17)25-19(27)7-6-15-12(2)16(9-22)20(28)23-13(15)3/h4-5,8,10H,6-7H2,1-3H3,(H,23,28)(H,24,25,27) |
| InChIKey | PCMUGODXQFQZCZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|