C25H26N4O4S — CID 55633682
N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 55633682) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55633682 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C3CCN(C(=O)CCc4ccccc4)CC3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H26N4O4S/c1-17-7-9-20(15-22(17)29(32)33)21-16-34-25(26-21)27-24(31)19-11-13-28(14-12-19)23(30)10-8-18-5-3-2-4-6-18/h2-7,9,15-16,19H,8,10-14H2,1H3,(H,26,27,31) |
| InChIKey | PHBFAZHIDKZVAO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|