C25H24N4O4S — CID 55469440
N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 55469440) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55469440 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C3CCN(C(=O)/C=C/c4ccccc4)CC3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H24N4O4S/c1-17-7-9-20(15-22(17)29(32)33)21-16-34-25(26-21)27-24(31)19-11-13-28(14-12-19)23(30)10-8-18-5-3-2-4-6-18/h2-10,15-16,19H,11-14H2,1H3,(H,26,27,31)/b10-8+ |
| InChIKey | IJWPBWLARGSVFW-CSKARUKUSA-N |
| XLogP | 4.92 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|