C26H34N4O2S — CID 43048081
N-[4-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 43048081) has the molecular formula C26H34N4O2S and a molecular weight of 466.65 g/mol. Its IUPAC name is N-[4-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[4-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43048081 |
| Molecular Formula | C26H34N4O2S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[4-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CC1CC(C)CN(Cc2csc(NC(=O)C3CCN(C(=O)/C=C/c4ccccc4)CC3)n2)C1 |
| InChI | InChI=1S/C26H34N4O2S/c1-19-14-20(2)16-29(15-19)17-23-18-33-26(27-23)28-25(32)22-10-12-30(13-11-22)24(31)9-8-21-6-4-3-5-7-21/h3-9,18-20,22H,10-17H2,1-2H3,(H,27,28,32)/b9-8+ |
| InChIKey | CMDIWZJKHTUFQK-CMDGGOBGSA-N |
| XLogP | 4.51 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|