C19H23N3OS — CID 60578284
(E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 60578284) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 60578284 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | CCc1nc(CN2CCN(C(=O)/C=C/c3ccccc3)CC2)cs1 |
| InChI | InChI=1S/C19H23N3OS/c1-2-18-20-17(15-24-18)14-21-10-12-22(13-11-21)19(23)9-8-16-6-4-3-5-7-16/h3-9,15H,2,10-14H2,1H3/b9-8+ |
| InChIKey | IPZSBVOKXQQCOV-CMDGGOBGSA-N |
| XLogP | 3.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|