C21H26FN3OS — CID 78881361
(E)-1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 78881361) has the molecular formula C21H26FN3OS and a molecular weight of 387.52 g/mol. Its IUPAC name is (E)-1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78881361 |
| Molecular Formula | C21H26FN3OS |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (E)-1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1nc(CN2CCN(C(=O)/C=C/c3cccc(F)c3)CC2)cs1 |
| InChI | InChI=1S/C21H26FN3OS/c1-21(2,3)20-23-18(15-27-20)14-24-9-11-25(12-10-24)19(26)8-7-16-5-4-6-17(22)13-16/h4-8,13,15H,9-12,14H2,1-3H3/b8-7+ |
| InChIKey | UKANWBZDJBTQGF-BQYQJAHWSA-N |
| XLogP | 3.94 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|