C18H18ClFN2OS — CID 39730721
(E)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 39730721) has the molecular formula C18H18ClFN2OS and a molecular weight of 364.87 g/mol. Its IUPAC name is (E)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 39730721 |
| Molecular Formula | C18H18ClFN2OS |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (E)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(F)c1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C18H18ClFN2OS/c19-17-6-5-16(24-17)13-21-8-10-22(11-9-21)18(23)7-4-14-2-1-3-15(20)12-14/h1-7,12H,8-11,13H2/b7-4+ |
| InChIKey | IBJHLIOFXRMSFF-QPJJXVBHSA-N |
| XLogP | 3.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|