C22H28ClN3O3S2 — CID 17446583
4-[(E)-3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide (PubChem CID 17446583) has the molecular formula C22H28ClN3O3S2 and a molecular weight of 482.07 g/mol. Its IUPAC name is 4-[(E)-3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 17446583 |
| Molecular Formula | C22H28ClN3O3S2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-[(E)-3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)N2CCN(Cc3ccc(Cl)s3)CC2)cc1 |
| InChI | InChI=1S/C22H28ClN3O3S2/c1-3-26(4-2)31(28,29)20-9-5-18(6-10-20)7-12-22(27)25-15-13-24(14-16-25)17-19-8-11-21(23)30-19/h5-12H,3-4,13-17H2,1-2H3/b12-7+ |
| InChIKey | GENPXSUMJWWYPE-KPKJPENVSA-N |
| XLogP | 3.79 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|