C19H18BrN3OS — CID 8892929
4-[(E)-3-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile (PubChem CID 8892929) has the molecular formula C19H18BrN3OS and a molecular weight of 416.34 g/mol. Its IUPAC name is 4-[(E)-3-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 8892929 |
| Molecular Formula | C19H18BrN3OS |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-[(E)-3-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/C(=O)N2CCN(Cc3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C19H18BrN3OS/c20-18-7-6-17(25-18)14-22-9-11-23(12-10-22)19(24)8-5-15-1-3-16(13-21)4-2-15/h1-8H,9-12,14H2/b8-5+ |
| InChIKey | BDAJOTIWBABKRV-VMPITWQZSA-N |
| XLogP | 3.74 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|